BIOPEP-UWM: Report
| ID | 10018 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 408.4477 | Monoisotopic mass | 408.2002 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Girgih AT, He R, Malomo SA, Offengenden M, Wu J, Aluko RE. | |
| Title | |
| Structural and functional characterization of hemp seed (Cannabis sativa L.) protein-derived antioxidant and antihypertensive peptides. J. Funct. Foods 6, 384–394. | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)O InChI= 1S/C19H28N4O6/c1-3-10(2)16(19(28)29)23-18(27)14(9-15(21)25)22-17(26)13(20)8-11-4-6-12(24)7-5-11/h4-7,10,13-14,16,24H,3,8-9,20H2,1-2H3,(H2,21,25)(H,22,26)(H,23,27)(H,28,29)/t10-,13-,14-,16-/m0/s1 InChIKey: MTEQZJFSEMXXRK-CFMVVWHZSA-N |
| Database reference: |
| ChEBI: ID 164981 PubChem: CID 145458577 |