BIOPEP-UWM: Report
| ID | 10029 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 684.8190 | Monoisotopic mass | 684.4044 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wali A., Mijiti Y., Yanhua G., Yili A., Aisa H. A., Kawuli A. | |
| Title | |
| Isolation and identification of a novel antioxidant peptide from chickpea (Cicer arietinum L.) sprout protein hydrolysates. Int. J. Pept. Res. Therapeut., 27, 219-227, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C32H56N6O10/c1-8-17(5)24(29(44)36-25(18(6)9-2)31(46)38-14-10-11-22(38)32(47)48)35-28(43)21(12-13-23(40)41)34-30(45)26(19(7)39)37-27(42)20(33)15-16(3)4/h16-22,24-26,39H,8-15,33H2,1-7H3,(H,34,45)(H,35,43)(H,36,44)(H,37,42)(H,40,41)(H,47,48)/t17-,18-,19+,20-,21-,22-,24-,25-,26-/m0/s1 InChIKey=BECLMNUKAKLJRN-HCERWSKXSA-N |
| Database reference: |