BIOPEP-UWM: Report
| ID | 10035 |
| Name | Hypotensive peptide |
| sequence |
| Function: | |||
| Lowering blood pressure in rats | |||
| Number of residues | 9 |
Activity code | hyp |
| Activity : | hypotensive |
|||
| Chemical mass | 1075.1538 | Monoisotopic mass | 1074.4538 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mas-Capdevila A., Iglesias-Carres L., Arola-Arnal A., Aragones G., Muguerza B., Bravo F. I. | |
| Title | |
| Implication of opioid receptors in the antihypertensive effect of a novel chicken foot-derived peptide. Biomolecules, 10, 992, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CC2=C[N]([H])C=N2)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H](CS)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCC(=O)O)C(=O)O InChI=1S/C45H66N14O15S/c1-21(2)36(59-37(65)22(3)46)44(72)57-28(15-23-7-5-4-6-8-23)40(68)52-26(10-13-33(48)61)39(67)55-29(16-24-18-50-20-51-24)41(69)56-30(17-34(49)62)42(70)58-31(19-75)43(71)53-25(9-12-32(47)60)38(66)54-27(45(73)74)11-14-35(63)64/h4-8,18,20-22,25-31,36,75H,9-17,19,46H2,1-3H3,(H2,47,60)(H2,48,61)(H2,49,62)(H,50,51)(H,52,68)(H,53,71)(H,54,66)(H,55,67)(H,56,69)(H,57,72)(H,58,70)(H,59,65)(H,63,64)(H,73,74)/t22-,25-,26-,27-,28-,29-,30-,31-,36-/m0/s1 InChIKey=GEMJGDVPHGIDQL-FBNOEUQTSA-N |
| Database reference: |