BIOPEP-UWM: Report
| ID | 10038 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 263.3144 | Monoisotopic mass | 263.0936 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang Y., Wang J., Zhu Z., Li X., Sun S., Wang W., Sadiq F. A. | |
| Title | |
| Identification and characterization of two novel antioxidant peptides from silkworm pupae protein hydrolysates. Eur. Food Res. Technol., 247, 343–352, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N[C@@]([H])(CS)C(=O)N[C@@]([H])(C)C(=O)O InChI=1S/C9H17N3O4S/c1-4(10)7(13)12-6(3-17)8(14)11-5(2)9(15)16/h4-6,17H,3,10H2,1-2H3,(H,11,14)(H,12,13)(H,15,16)/t4-,5-,6-/m0/s1 InChIKey=DECCMEWNXSNSDO-ZLUOBGJFSA-N |
| Database reference: |
| ChemSpider: ID 58808542 PubChem: CID 71354226 |