BIOPEP-UWM: Report
| ID | 10047 |
| Name | Soymorphin-6 amide |
| sequence |
| Function: | |||
| antioxidative | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 736.8555 | Monoisotopic mass | 736.3896 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Stefanucci A., Dimmito M. P., Tenore G., Pieretti S., Minosi P., Zengin G. et al. | |
| Title | |
| Plant-derived peptides rubiscolin-6, soymorphin-6 and their C-terminal amide derivatives: Pharmacokinetic properties and biological activity. J. Funct. Foods, 73, 104154, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N InChI=1S/C37H52N8O8/c1-20(2)30(35(51)41-26(32(40)48)19-29(39)47)44-36(52)31(21(3)4)43-33(49)27(18-22-9-6-5-7-10-22)42-34(50)28-11-8-16-45(28)37(53)25(38)17-23-12-14-24(46)15-13-23/h5-7,9-10,12-15,20-21,25-28,30-31,46H,8,11,16-19,38H2,1-4H3,(H2,39,47)(H2,40,48)(H,41,51)(H,42,50)(H,43,49)(H,44,52)/t25-,26-,27-,28-,30-,31-/m0/s1 InChIKey=QKBATNBKPZZFIN-DQUDHZTESA-N Opioid peptide according to the BIOPEP-UWM database of bioactive peptides (ID 7754), the EROP-Moscow database, the PepBank database; the PlantPepDB database |
| Database reference: |