BIOPEP-UWM: Report
| ID | 10049 |
| Name | Rubiscolin-6 amide |
| sequence |
| Function: | |||
| antioxidative | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 765.8933 | Monoisotopic mass | 765.4048 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Stefanucci A., Dimmito M. P., Tenore G., Pieretti S., Minosi P., Zengin G. et al. | |
| Title | |
| Plant-derived peptides rubiscolin-6, soymorphin-6 and their C-terminal amide derivatives: Pharmacokinetic properties and biological activity. J. Funct. Foods, 73, 104154, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N InChI=1S/C39H55N7O9/c1-22(2)17-29(35(51)42-28(34(41)50)20-24-9-6-5-7-10-24)43-37(53)31(21-33(48)49)44-36(52)30(18-23(3)4)45-38(54)32-11-8-16-46(32)39(55)27(40)19-25-12-14-26(47)15-13-25/h5-7,9-10,12-15,22-23,27-32,47H,8,11,16-21,40H2,1-4H3,(H2,41,50)(H,42,51)(H,43,53)(H,44,52)(H,45,54)(H,48,49)/t27-,28-,29-,30-,31-,32-/m0/s1 InChIKey=IKGWHAZYKWOZSZ-JNRWAQIZSA-N |
| Database reference: |