BIOPEP-UWM: Report
| ID | 10064 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| antioxidant | |||
| Number of residues | 4 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 544.5524 | Monoisotopic mass | 544.2161 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Shi C., Liu M., Ma Q., Zhao T., Liang L., Zhang B. | |
| Title | |
| Impact of tetrapeptide-FSEY on oxidative and physical stability of hazelnut oil-in-water emulsion. Foods, 10, 1400, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC2=CC=C(C=C2)O)C(=O)O InChI=1S/C26H32N4O9/c27-18(12-15-4-2-1-3-5-15)23(35)30-21(14-31)25(37)28-19(10-11-22(33)34)24(36)29-20(26(38)39)13-16-6-8-17(32)9-7-16/h1-9,18-21,31-32H,10-14,27H2,(H,28,37)(H,29,36)(H,30,35)(H,33,34)(H,38,39)/t18-,19-,20-,21-/m0/s1 InChIKey=PSTAQOOWNRZUQL-TUFLPTIASA-N |
| Database reference: |