BIOPEP-UWM: Report
| ID | 10065 |
| Name | Bile acid binding peptide |
| sequence |
| Function: | |||
| Bile acid binding | |||
| Number of residues | 4 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 581.7257 | Monoisotopic mass | 581.2663 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Imai K., Shimizu K., Honda H. | |
| Title | |
| Machine learning screening of bile acid‑binding peptides in a peptide database derived from food proteins. Sci. Rep., 11, 16123, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](C(C)C)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CC2=C[N]([H])C3=CC=CC=C23)C(=O)N[C@@H](CCSC)C(=O)O InChI=1S/C30H39N5O5S/c1-18(2)26(31)29(38)35-24(15-19-9-5-4-6-10-19)27(36)34-25(28(37)33-23(30(39)40)13-14-41-3)16-20-17-32-22-12-8-7-11-21(20)22/h4-12,17-18,23-26,32H,13-16,31H2,1-3H3,(H,33,37)(H,34,36)(H,35,38)(H,39,40)/t23-,24-,25-,26-/m0/s1 InChIKey=IHRINXKLTVZVAU-CQJMVLFOSA-N |
| Database reference: |