BIOPEP-UWM: Report
| ID | 10066 |
| Name | Bile acid binding peptide |
| sequence |
| Function: | |||
| Bile acid binding | |||
| Number of residues | 5 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 748.8695 | Monoisotopic mass | 748.4009 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Imai K., Shimizu K., Honda H. | |
| Title | |
| Machine learning screening of bile acid‑binding peptides in a peptide database derived from food proteins. Sci. Rep., 11, 16123, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H]([C@H](CC)C)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CC2=C[N]([H])C3=CC=CC=C23)C(=O)O InChI=1S/C37H52N10O7/c1-3-21(2)31(47-33(50)27(14-9-17-42-37(40)41)44-32(49)25(38)15-16-30(39)48)35(52)45-28(18-22-10-5-4-6-11-22)34(51)46-29(36(53)54)19-23-20-43-26-13-8-7-12-24(23)26/h4-8,10-13,20-21,25,27-29,31,43H,3,9,14-19,38H2,1-2H3,(H2,39,48)(H,44,49)(H,45,52)(H,46,51)(H,47,50)(H,53,54)(H4,40,41,42)/t21-,25-,27-,28-,29-,31-/m0/s1 InChIKey=OCQHWSVGTYTVII-VEXIPGRZSA-N |
| Database reference: |