BIOPEP-UWM: Report
| ID | 10068 |
| Name | Bile acid binding peptide |
| sequence |
| Function: | |||
| Bile acid binding | |||
| Number of residues | 6 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 792.9631 | Monoisotopic mass | 792.4843 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Imai K., Shimizu K., Honda H. | |
| Title | |
| Machine learning screening of bile acid‑binding peptides in a peptide database derived from food proteins. Sci. Rep., 11, 16123, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@H](Cc1c[nH]c2c1cccc2)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)O InChI=1S/C32H50N10O7/c1-16(2)25(41-27(44)20(33)9-7-13-37-32(35)36)30(47)40-23(14-18-15-38-21-10-6-5-8-19(18)21)28(45)42-26(17(3)4)29(46)39-22(31(48)49)11-12-24(34)43/h5-6,8,10,15-17,20,22-23,25-26,38H,7,9,11-14,33H2,1-4H3,(H2,34,43)(H,39,46)(H,40,47)(H,41,44)(H,42,45)(H,48,49)(H4,35,36,37)/t20-,22-,23-,25-,26-/m0/s1 InChIKey=JITSTFUCWQXCRA-ZYTYRFSCSA-N |
| Database reference: |