BIOPEP-UWM: Report
| ID | 10069 |
| Name | Bile acid binding peptide |
| sequence |
| Function: | |||
| Bile acid binding | |||
| Number of residues | 6 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 643.6418 | Monoisotopic mass | 643.2803 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Imai K., Shimizu K., Honda H. | |
| Title | |
| Machine learning screening of bile acid‑binding peptides in a peptide database derived from food proteins. Sci. Rep., 11, 16123, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)N)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C26H41N7O12/c1-12(2)8-16(26(44)45)32-24(42)17-4-3-7-33(17)25(43)14(5-6-20(36)37)31-23(41)15(10-21(38)39)30-19(35)11-29-22(40)13(27)9-18(28)34/h12-17H,3-11,27H2,1-2H3,(H2,28,34)(H,29,40)(H,30,35)(H,31,41)(H,32,42)(H,36,37)(H,38,39)(H,44,45)/t13-,14-,15-,16-,17-/m0/s1 InChIKey=VUYXEESFUDEAFL-WOYTXXSLSA-N |
| Database reference: |