BIOPEP-UWM: Report
| ID | 10070 |
| Name | Bile acid binding peptide |
| sequence |
| Function: | |||
| Bile acid binding | |||
| Number of residues | 7 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 862.0250 | Monoisotopic mass | 861.5057 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Imai K., Shimizu K., Honda H. | |
| Title | |
| Machine learning screening of bile acid‑binding peptides in a peptide database derived from food proteins. Sci. Rep., 11, 16123, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@H](CCC1)C(=O)N[C@@H]([C@H](O)C)C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)N[C@@H]([C@H](O)C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)O InChI=1S/C40H67N11O10/c1-22(2)20-30(39(60)61)49-35(56)27(14-8-9-17-41)46-34(55)28(16-11-19-45-40(42)43)47-37(58)31(23(3)52)51-36(57)29(21-25-12-6-5-7-13-25)48-38(59)32(24(4)53)50-33(54)26-15-10-18-44-26/h5-7,12-13,22-24,26-32,44,52-53H,8-11,14-21,41H2,1-4H3,(H,46,55)(H,47,58)(H,48,59)(H,49,56)(H,50,54)(H,51,57)(H,60,61)(H4,42,43,45)/t23-,24-,26+,27+,28+,29+,30+,31+,32+/m1/s1 InChIKey=CMCZBUHYMPUOJU-WKMHFICNSA-N |
| Database reference: |