BIOPEP-UWM: Report
| ID | 10071 |
| Name | Bile acid binding peptide |
| sequence |
| Function: | |||
| Bile acid binding | |||
| Number of residues | 7 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 922.0372 | Monoisotopic mass | 921.5017 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Imai K., Shimizu K., Honda H. | |
| Title | |
| Machine learning screening of bile acid‑binding peptides in a peptide database derived from food proteins. Sci. Rep., 11, 16123, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CCCCN)C(=O)N[C@@H]([C@H](CC)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@H](CCC(=O)N)C(=O)O InChI=1S/C40H67N13O12/c1-3-21(2)32(53-33(58)24(42)7-4-5-17-41)38(63)52-29(20-54)37(62)49-26(13-15-30(43)56)35(60)48-25(8-6-18-47-40(45)46)34(59)51-28(19-22-9-11-23(55)12-10-22)36(61)50-27(39(64)65)14-16-31(44)57/h9-12,21,24-29,32,54-55H,3-8,13-20,41-42H2,1-2H3,(H2,43,56)(H2,44,57)(H,48,60)(H,49,62)(H,50,61)(H,51,59)(H,52,63)(H,53,58)(H,64,65)(H4,45,46,47)/t21-,24-,25-,26-,27-,28-,29-,32-/m0/s1 InChIKey=NMEKSAJDWCZRAQ-CNSUKLJESA-N |
| Database reference: |