BIOPEP-UWM: Report
| ID | 10072 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative peptide | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 408.4494 | Monoisotopic mass | 408.1792 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Pearman N. A., Ronander E., Smith A. M., Morris G. A. | |
| Title | |
| The identification and characterisation of novel bioactive peptides derived from porcine liver. Curr. Res. Food Sci., 3, 314-321, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CC2=C[N]([H])C3=CC=CC=C23)C(=O)NCC(=O)O InChI=1S/C22H24N4O4/c23-17(10-14-6-2-1-3-7-14)21(29)26-19(22(30)25-13-20(27)28)11-15-12-24-18-9-5-4-8-16(15)18/h1-9,12,17,19,24H,10-11,13,23H2,(H,25,30)(H,26,29)(H,27,28)/t17-,19-/m0/s1 InChIKey=ZVJGAXNBBKPYOE-HKUYNNGSSA-N |
| Database reference: |
| ChEBI: ID 161918 PubChem: CID 44611826 |