BIOPEP-UWM: Report
| ID | 10074 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative peptide | |||
| Number of residues | 9 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 930.0526 | Monoisotopic mass | 929.4842 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Pearman N. A., Ronander E., Smith A. M., Morris G. A. | |
| Title | |
| The identification and characterisation of novel bioactive peptides derived from porcine liver. Curr. Res. Food Sci., 3, 314-321, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CO)C(=O)N[C@@H](CC(=O)O)C(=O)N1[C@@H](CCC1)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC3=CC=CC=C3)C(=O)N[C@@H](C(C)C)C(=O)NCC(=O)O InChI=1S/C44H67N9O13/c1-23(2)18-28(47-40(62)31-14-10-16-52(31)44(66)32-15-11-17-53(32)43(65)30(20-33(55)56)49-37(59)27(45)22-54)38(60)51-36(25(5)6)42(64)48-29(19-26-12-8-7-9-13-26)39(61)50-35(24(3)4)41(63)46-21-34(57)58/h7-9,12-13,23-25,27-32,35-36,54H,10-11,14-22,45H2,1-6H3,(H,46,63)(H,47,62)(H,48,64)(H,49,59)(H,50,61)(H,51,60)(H,55,56)(H,57,58)/t27-,28-,29-,30-,31-,32-,35-,36-/m0/s1 InChIKey=FXWUZZNZDVWJAR-WBAWQGJISA-N |
| Database reference: |