BIOPEP-UWM: Report
| ID | 10080 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 8 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 1014.1964 | Monoisotopic mass | 1013.4988 | |
| IC50 : | 31.63 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kaewsahnguan T., Noitang S., Sangtanoo P., Srimongkol P., Saisavoey T., Reamtong O., Choowongkomon K., Karnchanatat A. | |
| Title | |
| A novel angiotensin I-converting enzyme inhibitory peptide derived from the trypsin hydrolysates of salmon bone proteins. PLoS ONE, 16, e0256595, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CS)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC2=CC=C(C=C2)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O InChI=1S/C47H71N11O12S/c1-25(2)20-34(42(65)52-27(5)39(62)54-33(46(69)70)12-9-19-51-47(49)50)55-41(64)32(17-18-38(60)61)53-44(67)36(23-29-13-15-30(59)16-14-29)57-43(66)35(21-26(3)4)56-45(68)37(24-71)58-40(63)31(48)22-28-10-7-6-8-11-28/h6-8,10-11,13-16,25-27,31-37,59,71H,9,12,17-24,48H2,1-5H3,(H,52,65)(H,53,67)(H,54,62)(H,55,64)(H,56,68)(H,57,66)(H,58,63)(H,60,61)(H,69,70)(H4,49,50,51)/t27-,31-,32-,33-,34-,35-,36-,37-/m0/s1 InChIKey=VPZWDZGLXNQJAV-IFUGPJDHSA-N |
| Database reference: |