BIOPEP-UWM: Report
| ID | 10088 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5; MEROPS ID: S09.003) | |||
| Number of residues | 4 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 498.5700 | Monoisotopic mass | 498.2470 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Amigo L., MartÃnez-Maqueda D., Hernández-Ledesma B. | |
| Title | |
| In silico and in vitro analysis of multifunctionality of animal food-derived peptides. Foods, 9, 991, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1)O)C(=O)NCC(=O)N[C@@H](CC2=CC=CC=C2)C(=O)N[C@@H](CC(C)C)C(=O)O InChI=1S/C26H34N4O6/c1-16(2)12-22(26(35)36)30-25(34)21(14-17-6-4-3-5-7-17)29-23(32)15-28-24(33)20(27)13-18-8-10-19(31)11-9-18/h3-11,16,20-22,31H,12-15,27H2,1-2H3,(H,28,33)(H,29,32)(H,30,34)(H,35,36)/t20-,21-,22-/m0/s1 InChIKey=NJQMBFDOYQGROG-FKBYEOEOSA-N Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides (ID 10089); the MBPDB database |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 10089 ChEMBL: ID CHEMBL15695 ChemSpider: ID 23114285 EPA DSSTOX: ID DTXSID00575703 MBPDB: Peptide YGFL PubChem: CID 15609829 |