BIOPEP-UWM: Report
| ID | 10091 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 2 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 289.2876 | Monoisotopic mass | 289.1382 | |
| IC50 : | 110.50 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wei D., Fan W., Xu Y. | |
| Title | |
| Identification of water-soluble peptides in distilled spent grain and its angiotensin converting enzyme (ACE) inhibitory activity based on UPLC-Q-TOF-MS and proteomics analysis. Food Chem., 353, 129521, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C10H19N5O5/c11-5(4-7(16)17)8(18)15-6(9(19)20)2-1-3-14-10(12)13/h5-6H,1-4,11H2,(H,15,18)(H,16,17)(H,19,20)(H4,12,13,14)/t5-,6-/m0/s1 InChIKey=PSZNHSNIGMJYOZ-WDSKDSINSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8769) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 8769 BRENDA: Ligand Asp-Arg ChEBI: ID 73445 ChEMBL: ID CHEMBL1222329 ChemSpider: ID 17279431 FeptideDB: ID 8769 J-GLOBAL: ID 200907039358420013 Metabolights: ID MTBLC73445 Nikkaji: ID J2.266.679G PubChem: CID 16122509 SureChEMBL: ID SCHEMBL3910834 |