BIOPEP-UWM: Report
| ID | 10093 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5; MEROPS ID: S09.003) | |||
| Number of residues | 6 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 541.5534 | Monoisotopic mass | 541.2488 | |
| IC50 : | 307.40 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wei D., Fan W., Xu Y. | |
| Title | |
| Identification of water-soluble peptides in distilled spent grain and its angiotensin converting enzyme (ACE) inhibitory activity based on UPLC-Q-TOF-MS and proteomics analysis. Food Chem., 353, 129521, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)N)C(=O)NCC(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)O InChI=1S/C22H35N7O9/c1-11(30)18(22(37)38)27-20(35)13-4-2-7-29(13)21(36)14-5-3-6-28(14)17(33)10-25-16(32)9-26-19(34)12(23)8-15(24)31/h11-14,18,30H,2-10,23H2,1H3,(H2,24,31)(H,25,32)(H,26,34)(H,27,35)(H,37,38)/t11-,12+,13+,14+,18+/m1/s1 InChIKey=SWEFKAVJZMNXFK-LLLAAFKUSA-N |
| Database reference: |