BIOPEP-UWM: Report
| ID | 10094 |
| Name | Antithrombotic peptide |
| sequence |
| Function: | |||
| Inhibitor of thrombin (EC 3.4.21.5) (MEROPS ID: S01.217) | |||
| Number of residues | 11 |
Activity code | at |
| Activity : | antithrombotic |
|||
| Chemical mass | 1359.4319 | Monoisotopic mass | 1358.6542 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Cheng S., Wang Y., Chen H., Liu H., Wang L., Battino M., Yao X., Zhu B., Du M. | |
| Title | |
| Anticoagulant dodecapeptide suppresses thrombosis in vivo by inhibiting the thrombin exosite-I binding site. J. Agric. Food Chem., 69, 10920–10931, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C57H94N14O24/c1-8-28(6)45(58)55(93)68-35(16-22-44(82)83)49(87)65-34(15-21-43(80)81)52(90)71-38(25-27(4)5)54(92)67-32(13-19-41(76)77)48(86)64-33(14-20-42(78)79)51(89)70-37(24-26(2)3)53(91)66-30(11-17-39(72)73)47(85)62-29(7)46(84)63-31(12-18-40(74)75)50(88)69-36(56(94)95)10-9-23-61-57(59)60/h26-38,45H,8-25,58H2,1-7H3,(H,62,85)(H,63,84)(H,64,86)(H,65,87)(H,66,91)(H,67,92)(H,68,93)(H,69,88)(H,70,89)(H,71,90)(H,72,73)(H,74,75)(H,76,77)(H,78,79)(H,80,81)(H,82,83)(H,94,95)(H4,59,60,61)/t28-,29-,30-,31-,32-,33-,34-,35-,36-,37-,38-,45-/m0/s1 InChIKey=SAXXYZDPRFCUMQ-UPFFINHESA-N |
| Database reference: |