BIOPEP-UWM: Report
| ID | 10103 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 14 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 1503.8008 | Monoisotopic mass | 1502.8140 | |
| IC50 : | 21.29 µM |
|||
| Bibliographic data: | |
| Authors | |
| Liu L., Chen J., Li X. | |
| Title | |
| Novel peptides with α-glucosidase inhibitory activity from Changii radix hydrolysates. Process Biochem., 111, 200–206, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CCCCN)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H]([C@H](CC)C)C(=O)N[C@@H]([C@H](CC)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](C)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC3=CC=CC=C3)C(=O)O N[C@@H](CCCCN)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H]([C@H](CC)C)C(=O)N[C@@H]([C@H](CC)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](C)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC3=CC=CC=C3)C(=O)O InChIKey=IHESGKYJYGVQMH-KQVBSNKTSA-N |
| Database reference: |