BIOPEP-UWM: Report
| ID | 10104 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 7 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 927.0335 | Monoisotopic mass | 926.3943 | |
| IC50 : | 1190.94 µM |
|||
| Bibliographic data: | |
| Authors | |
| Liu L., Chen J., Li X. | |
| Title | |
| Novel peptides with α-glucosidase inhibitory activity from Changii radix hydrolysates. Process Biochem., 111, 200–206, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CO)C(=O)N[C@@H]([C@H](O)C)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC2=C[N]([H])C3=CC=CC=C23)C(=O)O InChI=1S/C42H58N10O12S/c1-22(54)35(52-36(57)26(43)21-53)41(62)50-31(18-23-8-4-3-5-9-23)40(61)48-29(13-15-34(45)56)37(58)47-28(12-14-33(44)55)38(59)49-30(16-17-65-2)39(60)51-32(42(63)64)19-24-20-46-27-11-7-6-10-25(24)27/h3-11,20,22,26,28-32,35,46,53-54H,12-19,21,43H2,1-2H3,(H2,44,55)(H2,45,56)(H,47,58)(H,48,61)(H,49,59)(H,50,62)(H,51,60)(H,52,57)(H,63,64)/t22-,26+,28+,29+,30+,31+,32+,35+/m1/s1 InChIKey=PNTIPTFUYQGCDY-WBZWQVOCSA-N |
| Database reference: |