BIOPEP-UWM: Report
| ID | 10128 |
| Name | Bile acid binding peptide |
| sequence |
| Function: | |||
| Bile acid binding | |||
| Number of residues | 6 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 798.8769 | Monoisotopic mass | 798.3786 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Imai K., Takeuchi Y., Shimizu K., Honda H. | |
| Title | |
| In silico screening of a bile acid micelle disruption peptide for oral consumptions from edible peptide database. Foods, 10, 2496, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H]([C@H](CC)C)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H]([C@H](CC)C)C(=O)N[C@@H](CC2=CC=C(C=C2)O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)O InChI=1S/C39H54N6O12/c1-5-21(3)32(40)37(54)43-28(18-23-10-8-7-9-11-23)36(53)45-33(22(4)6-2)38(55)44-27(19-24-12-14-25(46)15-13-24)34(51)42-29(20-31(49)50)35(52)41-26(39(56)57)16-17-30(47)48/h7-15,21-22,26-29,32-33,46H,5-6,16-20,40H2,1-4H3,(H,41,52)(H,42,51)(H,43,54)(H,44,55)(H,45,53)(H,47,48)(H,49,50)(H,56,57)/t21-,22-,26-,27-,28-,29-,32-,33-/m0/s1 InChIKey=RQSRGUIOTTZEGN-ZVBMOMSPSA-N |
| Database reference: |