BIOPEP-UWM: Report
| ID | 10129 |
| Name | Bile acid binding peptide |
| sequence |
| Function: | |||
| Bile acid binding | |||
| Number of residues | 6 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 855.9298 | Monoisotopic mass | 855.3790 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Imai K., Takeuchi Y., Shimizu K., Honda H. | |
| Title | |
| In silico screening of a bile acid micelle disruption peptide for oral consumptions from edible peptide database. Foods, 10, 2496, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[N]([H])C2=CC=CC=C12)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC3=CC=CC=C3)C(=O)N[C@@H]([C@H](CC)C)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC4=CC=CC=C4)C(=O)O InChI=1S/C44H53N7O11/c1-3-25(2)38(43(60)49-34(23-37(54)55)41(58)50-35(44(61)62)21-27-14-8-5-9-15-27)51-42(59)33(20-26-12-6-4-7-13-26)48-40(57)32(18-19-36(52)53)47-39(56)30(45)22-28-24-46-31-17-11-10-16-29(28)31/h4-17,24-25,30,32-35,38,46H,3,18-23,45H2,1-2H3,(H,47,56)(H,48,57)(H,49,60)(H,50,58)(H,51,59)(H,52,53)(H,54,55)(H,61,62)/t25-,30-,32-,33-,34-,35-,38-/m0/s1 InChIKey=NVJNOWPZGSTQFU-UPYMCYABSA-N |
| Database reference: |