BIOPEP-UWM: Report
| ID | 10136 |
| Name | Anti-inflammatory peptide |
| sequence |
| Function: | |||
| Anti-inflammatory | |||
| Number of residues | 6 |
Activity code | ai |
| Activity : | anti inflammatory |
|||
| Chemical mass | 510.5823 | Monoisotopic mass | 510.2793 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Fu L., Xing L., Hao Y., Yang Z., Teng S., Wei L., Zhang W. | |
| Title | |
| The anti-inflammatory effects of dry-cured ham derived peptides in RAW264.7 macrophage cells. J. Funct. Foods, 87, 104827, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C23H38N6O7/c1-13(2)10-15(23(35)36)27-22(34)17-7-5-9-29(17)19(31)12-25-20(32)14(3)26-21(33)16-6-4-8-28(16)18(30)11-24/h13-17H,4-12,24H2,1-3H3,(H,25,32)(H,26,33)(H,27,34)(H,35,36)/t14-,15-,16-,17-/m0/s1 InChIKey=NRBDTEIMDWZMSD-QAETUUGQSA-N |
| Database reference: |