BIOPEP-UWM: Report
| ID | 10137 |
| Name | Anti-inflammatory peptide |
| sequence |
| Function: | |||
| Anti-inflammatory | |||
| Number of residues | 6 |
Activity code | ai |
| Activity : | anti inflammatory |
|||
| Chemical mass | 494.5400 | Monoisotopic mass | 494.2481 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Fu L., Xing L., Hao Y., Yang Z., Teng S., Wei L., Zhang W. | |
| Title | |
| The anti-inflammatory effects of dry-cured ham derived peptides in RAW264.7 macrophage cells. J. Funct. Foods, 87, 104827, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C22H34N6O7/c1-13(20(32)28-10-4-7-16(28)22(34)35)25-17(29)12-24-19(31)14-5-2-9-27(14)21(33)15-6-3-8-26(15)18(30)11-23/h13-16H,2-12,23H2,1H3,(H,24,31)(H,25,29)(H,34,35)/t13-,14-,15-,16-/m0/s1 InChIKey=GAWCJSBGXRAXBB-VGWMRTNUSA-N |
| Database reference: |