BIOPEP-UWM: Report
| ID | 10144 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 5 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 570.6407 | Monoisotopic mass | 570.3229 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Li M., Fan W., Xu Y. | |
| Title | |
| Identification of angiotensin converting enzyme (ACE) inhibitory and antioxidant peptides derived from Pixian broad bean paste. LWT, 151, 112221, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CCCCN)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C23H42N10O7/c24-8-2-1-5-14(31-19(36)13(25)11-17(26)34)20(37)30-12-18(35)33-10-4-7-16(33)21(38)32-15(22(39)40)6-3-9-29-23(27)28/h13-16H,1-12,24-25H2,(H2,26,34)(H,30,37)(H,31,36)(H,32,38)(H,39,40)(H4,27,28,29)/t13-,14-,15-,16-/m0/s1 InChIKey=OYPNSFBSOLERIS-VGWMRTNUSA-N Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides (ID 10149) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides; ID 10149 |