BIOPEP-UWM: Report
| ID | 10147 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 641.7362 | Monoisotopic mass | 641.2833 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Li M., Fan W., Xu Y. | |
| Title | |
| Identification of angiotensin converting enzyme (ACE) inhibitory and antioxidant peptides derived from Pixian broad bean paste. LWT, 151, 112221, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(O)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CS)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)O InChI=1S/C27H43N7O9S/c1-14(35)21(29)26(41)33-11-3-6-18(33)23(38)31-16(13-44)24(39)34-12-4-7-19(34)25(40)32-10-2-5-17(32)22(37)30-15(27(42)43)8-9-20(28)36/h14-19,21,35,44H,2-13,29H2,1H3,(H2,28,36)(H,30,37)(H,31,38)(H,42,43)/t14-,15+,16+,17+,18+,19+,21+/m1/s1 InChIKey=BZTLEZMDKSFROA-IALLDWONSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides (ID 10146) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 10146 |