BIOPEP-UWM: Report
| ID | 10150 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 587.6216 | Monoisotopic mass | 587.2905 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Li M., Fan W., Xu Y. | |
| Title | |
| Identification of angiotensin converting enzyme (ACE) inhibitory and antioxidant peptides derived from Pixian broad bean paste. LWT, 151, 112221, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)O InChI=1S/C24H41N7O10/c1-10(2)5-13(30-23(39)15(8-17(26)32)28-20(36)12(25)7-19(34)35)21(37)29-14(6-11(3)4)22(38)31-16(24(40)41)9-18(27)33/h10-16H,5-9,25H2,1-4H3,(H2,26,32)(H2,27,33)(H,28,36)(H,29,37)(H,30,39)(H,31,38)(H,34,35)(H,40,41)/t12-,13-,14-,15-,16-/m0/s1 InChIKey=JZEVQEDUCAXOJY-QXKUPLGCSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides (ID 10145) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 10145 |