BIOPEP-UWM: Report
| ID | 10152 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 4 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 513.6275 | Monoisotopic mass | 513.2942 | |
| IC50 : | 24.12 µM |
|||
| Bibliographic data: | |
| Authors | |
| Aiemratchanee P., Panyawechamontri K., Phaophu P., Reamtong O., Panbangred W. | |
| Title | |
| In vitro antihypertensive activity of bioactive peptides derived from porcine blood corpuscle and plasma proteins. Int. J. Food Sci. Technol., 56, 2315–2324, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](C(C)C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC2=C[N]([H])C3=CC=CC=C23)C(=O)O InChI=1S/C27H39N5O5/c1-15(2)12-20(30-25(34)22-10-7-11-32(22)26(35)23(28)16(3)4)24(33)31-21(27(36)37)13-17-14-29-19-9-6-5-8-18(17)19/h5-6,8-9,14-16,20-23,29H,7,10-13,28H2,1-4H3,(H,30,34)(H,31,33)(H,36,37)/t20-,21-,22-,23-/m0/s1 InChIKey=FPRZYIUJYIBWJN-MLCQCVOFSA-N |
| Database reference: |