BIOPEP-UWM: Report
| ID | 10155 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| antioxidant | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 661.7016 | Monoisotopic mass | 661.3061 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Shi C., Liu M., Zhao H., Lv Z., Liang L., Zhang B. | |
| Title | |
| A novel insight into screening for antioxidant peptides from hazelnut protein: based on the properties of amino acid residues. Antioxidants, 11, 127, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CO)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C30H43N7O10/c1-3-15(2)25(37-26(42)18(31)8-10-23(32)39)29(45)34-20(9-11-24(40)41)27(43)36-22(14-38)28(44)35-21(30(46)47)12-16-13-33-19-7-5-4-6-17(16)19/h4-7,13,15,18,20-22,25,33,38H,3,8-12,14,31H2,1-2H3,(H2,32,39)(H,34,45)(H,35,44)(H,36,43)(H,37,42)(H,40,41)(H,46,47)/t15-,18-,20-,21-,22-,25-/m0/s1 InChIKey=HYNCFJZSFHOEIX-OVVMPSBWSA-N |
| Database reference: |