BIOPEP-UWM: Report
| ID | 10156 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| antioxidant | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 753.7539 | Monoisotopic mass | 753.2959 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Shi C., Liu M., Zhao H., Lv Z., Liang L., Zhang B. | |
| Title | |
| A novel insight into screening for antioxidant peptides from hazelnut protein: based on the properties of amino acid residues. Antioxidants, 11, 127, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)NCC(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C35H43N7O12/c36-22(18-43)31(49)40-24(10-12-29(45)46)32(50)38-17-28(44)39-26(14-19-6-2-1-3-7-19)34(52)41-25(11-13-30(47)48)33(51)42-27(35(53)54)15-20-16-37-23-9-5-4-8-21(20)23/h1-9,16,22,24-27,37,43H,10-15,17-18,36H2,(H,38,50)(H,39,44)(H,40,49)(H,41,52)(H,42,51)(H,45,46)(H,47,48)(H,53,54)/t22-,24-,25-,26-,27-/m0/s1 InChIKey=OBLDKDDXAKYIQU-KGRAHGMMSA-N |
| Database reference: |