BIOPEP-UWM: Report
| ID | 10158 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| antioxidant | |||
| Number of residues | 9 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1169.3337 | Monoisotopic mass | 1168.5101 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Shi C., Liu M., Zhao H., Lv Z., Liang L., Zhang B. | |
| Title | |
| A novel insight into screening for antioxidant peptides from hazelnut protein: based on the properties of amino acid residues. Antioxidants, 11, 127, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CS)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CCSC)C(=O)O InChI=1S/C47H76N16O15S2/c1-22(2)17-30(60-38(69)25(48)19-36(51)67)42(73)62-32(20-37(52)68)44(75)57-28(11-13-35(50)66)41(72)63-33(21-79)45(76)58-27(10-12-34(49)65)40(71)56-26(5-4-15-55-47(53)54)39(70)61-31(18-23-6-8-24(64)9-7-23)43(74)59-29(46(77)78)14-16-80-3/h6-9,22,25-33,64,79H,4-5,10-21,48H2,1-3H3,(H2,49,65)(H2,50,66)(H2,51,67)(H2,52,68)(H,56,71)(H,57,75)(H,58,76)(H,59,74)(H,60,69)(H,61,70)(H,62,73)(H,63,72)(H,77,78)(H4,53,54,55)/t25-,26-,27-,28-,29-,30-,31-,32-,33-/m0/s1 InChIKey=WXARMVQRQIXRHW-MBZPSOJASA-N |
| Database reference: |