BIOPEP-UWM: Report
| ID | 10172 |
| Name | Zinc binding peptide |
| sequence |
| Function: | |||
| Zinc binding | |||
| Number of residues | 10 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 1172.2393 | Monoisotopic mass | 1171.5701 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Udechukwu M. C., Dang C., Udenigwe C. C. | |
| Title | |
| Identification of zinc-binding peptides in ADAM17-inhibiting whey protein hydrolysates using IMAC-Zn2+ coupled with shotgun peptidomics. Food Prod. Process. Nutr., 3, 5, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C49H81N13O20/c1-21(2)18-25(50)39(72)59-36(22(3)4)45(78)55-26(10-8-16-53-49(51)52)40(73)61-38(24(7)63)47(80)62-17-9-11-31(62)44(77)54-27(12-14-32(64)65)41(74)60-37(23(5)6)46(79)58-30(20-35(70)71)43(76)57-29(19-34(68)69)42(75)56-28(48(81)82)13-15-33(66)67/h21-31,36-38,63H,8-20,50H2,1-7H3,(H,54,77)(H,55,78)(H,56,75)(H,57,76)(H,58,79)(H,59,72)(H,60,74)(H,61,73)(H,64,65)(H,66,67)(H,68,69)(H,70,71)(H,81,82)(H4,51,52,53)/t24-,25+,26+,27+,28+,29+,30+,31+,36+,37+,38+/m1/s1 InChIKey=WZZUAMVPMGGKKS-LDIFGFDFSA-N |
| Database reference: |