BIOPEP-UWM: Report
| ID | 10175 |
| Name | Zinc binding peptide |
| sequence |
| Function: | |||
| Zinc binding | |||
| Number of residues | 9 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 1032.2301 | Monoisotopic mass | 1031.5996 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Udechukwu M. C., Dang C., Udenigwe C. C. | |
| Title | |
| Identification of zinc-binding peptides in ADAM17-inhibiting whey protein hydrolysates using IMAC-Zn2+ coupled with shotgun peptidomics. Food Prod. Process. Nutr., 3, 5, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C49H81N11O13/c1-7-28(4)39(48(71)60-25-15-20-36(60)45(68)53-29(5)41(64)57-38(27(2)3)46(69)56-35(49(72)73)26-31-16-9-8-10-17-31)58-43(66)34(19-12-14-24-51)55-47(70)40(30(6)61)59-44(67)33(18-11-13-23-50)54-42(65)32(52)21-22-37(62)63/h8-10,16-17,27-30,32-36,38-40,61H,7,11-15,18-26,50-52H2,1-6H3,(H,53,68)(H,54,65)(H,55,70)(H,56,69)(H,57,64)(H,58,66)(H,59,67)(H,62,63)(H,72,73)/t28-,29-,30+,32-,33-,34-,35-,36-,38-,39-,40-/m0/s1 InChIKey=LIKPJENJIMFYQA-FSIURCDRSA-N |
| Database reference: |