BIOPEP-UWM: Report
| ID | 10176 |
| Name | Zinc binding peptide |
| sequence |
| Function: | |||
| Zinc binding | |||
| Number of residues | 11 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 1175.3703 | Monoisotopic mass | 1174.6576 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Udechukwu M. C., Dang C., Udenigwe C. C. | |
| Title | |
| Identification of zinc-binding peptides in ADAM17-inhibiting whey protein hydrolysates using IMAC-Zn2+ coupled with shotgun peptidomics. Food Prod. Process. Nutr., 3, 5, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(O)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C55H90N12O16/c1-27(2)26-34(45(72)58-32(18-20-39(56)69)51(78)64-22-10-14-35(64)46(73)59-33(55(82)83)19-21-40(70)71)60-47(74)36-15-11-23-65(36)52(79)38-17-13-25-67(38)54(81)44(30(7)8)63-50(77)43(29(5)6)62-49(76)42(28(3)4)61-48(75)37-16-12-24-66(37)53(80)41(57)31(9)68/h27-38,41-44,68H,10-26,57H2,1-9H3,(H2,56,69)(H,58,72)(H,59,73)(H,60,74)(H,61,75)(H,62,76)(H,63,77)(H,70,71)(H,82,83)/t31-,32+,33+,34+,35+,36+,37+,38+,41+,42+,43+,44+/m1/s1 InChIKey=PADQUUUCTJHSFR-OIZOTOQVSA-N |
| Database reference: |