BIOPEP-UWM: Report
| ID | 10177 |
| Name | Zinc binding peptide |
| sequence |
| Function: | |||
| Zinc binding | |||
| Number of residues | 9 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 999.2019 | Monoisotopic mass | 998.6105 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Udechukwu M. C., Dang C., Udenigwe C. C. | |
| Title | |
| Identification of zinc-binding peptides in ADAM17-inhibiting whey protein hydrolysates using IMAC-Zn2+ coupled with shotgun peptidomics. Food Prod. Process. Nutr., 3, 5, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(C(C)C)C(=O)NCC(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)O InChI=1S/C45H82N12O13/c1-9-25(7)36(43(67)54-31(45(69)70)20-32(49)58)55-33(59)22-50-42(66)35(24(5)6)56-39(63)28(16-12-14-18-47)51-41(65)30(21-34(60)61)52-40(64)29(19-23(3)4)53-44(68)37(26(8)10-2)57-38(62)27(48)15-11-13-17-46/h23-31,35-37H,9-22,46-48H2,1-8H3,(H2,49,58)(H,50,66)(H,51,65)(H,52,64)(H,53,68)(H,54,67)(H,55,59)(H,56,63)(H,57,62)(H,60,61)(H,69,70)/t25-,26-,27-,28-,29-,30-,31-,35-,36-,37-/m0/s1 InChIKey=XZIOQBMGFOWORX-JEYMWEMISA-N |
| Database reference: |