BIOPEP-UWM: Report
| ID | 10178 |
| Name | Zinc binding peptide |
| sequence |
| Function: | |||
| Zinc binding | |||
| Number of residues | 9 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 997.0970 | Monoisotopic mass | 996.5110 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Udechukwu M. C., Dang C., Udenigwe C. C. | |
| Title | |
| Identification of zinc-binding peptides in ADAM17-inhibiting whey protein hydrolysates using IMAC-Zn2+ coupled with shotgun peptidomics. Food Prod. Process. Nutr., 3, 5, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CO)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)O InChI=1S/C44H72N10O16/c1-7-22(5)34(41(66)49-26(44(69)70)19-30(45)56)51-37(62)25(14-16-32(59)60)47-38(63)28-11-9-17-53(28)43(68)29-12-10-18-54(29)42(67)27(20-55)50-36(61)24(13-15-31(57)58)48-40(65)35(23(6)8-2)52-39(64)33(46)21(3)4/h21-29,33-35,55H,7-20,46H2,1-6H3,(H2,45,56)(H,47,63)(H,48,65)(H,49,66)(H,50,61)(H,51,62)(H,52,64)(H,57,58)(H,59,60)(H,69,70)/t22-,23-,24-,25-,26-,27-,28-,29-,33-,34-,35-/m0/s1 InChIKey=BULQLWQZVFGZMC-RFARBTCJSA-N |
| Database reference: |