BIOPEP-UWM: Report
| ID | 10179 |
| Name | Zinc binding peptide |
| sequence |
| Function: | |||
| Zinc binding | |||
| Number of residues | 6 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 816.9433 | Monoisotopic mass | 816.4270 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Udechukwu M. C., Dang C., Udenigwe C. C. | |
| Title | |
| Identification of zinc-binding peptides in ADAM17-inhibiting whey protein hydrolysates using IMAC-Zn2+ coupled with shotgun peptidomics. Food Prod. Process. Nutr., 3, 5, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C41H56N10O8/c1-23(2)16-33(38(55)47-24(3)36(53)49-35(19-27-21-44-22-46-27)40(57)48-32(41(58)59)10-6-7-15-42)51-39(56)34(18-26-20-45-31-9-5-4-8-29(26)31)50-37(54)30(43)17-25-11-13-28(52)14-12-25/h4-5,8-9,11-14,20-24,30,32-35,45,52H,6-7,10,15-19,42-43H2,1-3H3,(H,44,46)(H,47,55)(H,48,57)(H,49,53)(H,50,54)(H,51,56)(H,58,59)/t24-,30-,32-,33-,34-,35-/m0/s1 InChIKey=ZKGOYXDHPPYNSV-ILGUYMTBSA-N |
| Database reference: |