BIOPEP-UWM: Report
| ID | 10180 |
| Name | Zinc binding peptide |
| sequence |
| Function: | |||
| Zinc binding | |||
| Number of residues | 8 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 903.1164 | Monoisotopic mass | 902.5572 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Udechukwu M. C., Dang C., Udenigwe C. C. | |
| Title | |
| Identification of zinc-binding peptides in ADAM17-inhibiting whey protein hydrolysates using IMAC-Zn2+ coupled with shotgun peptidomics. Food Prod. Process. Nutr., 3, 5, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C44H74N10O10/c1-7-26(4)35(52-39(58)31(19-12-14-22-46)49-42(61)36(28(6)55)53-38(57)30(47)18-11-13-21-45)43(62)54-23-15-20-33(54)40(59)48-27(5)37(56)51-34(25(2)3)41(60)50-32(44(63)64)24-29-16-9-8-10-17-29/h8-10,16-17,25-28,30-36,55H,7,11-15,18-24,45-47H2,1-6H3,(H,48,59)(H,49,61)(H,50,60)(H,51,56)(H,52,58)(H,53,57)(H,63,64)/t26-,27-,28+,30-,31-,32-,33-,34-,35-,36-/m0/s1 InChIKey=PTLPIMOVWNVYTB-OUXCOFFLSA-N |
| Database reference: |