BIOPEP-UWM: Report
| ID | 10182 |
| Name | Zinc binding peptide |
| sequence |
| Function: | |||
| Zinc binding | |||
| Number of residues | 7 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 931.9826 | Monoisotopic mass | 931.4272 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Udechukwu M. C., Dang C., Udenigwe C. C. | |
| Title | |
| Identification of zinc-binding peptides in ADAM17-inhibiting whey protein hydrolysates using IMAC-Zn2+ coupled with shotgun peptidomics. Food Prod. Process. Nutr., 3, 5, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C42H61N9O15/c1-22(52)35(51-36(59)27(45)20-33(55)56)41(64)49-31(21-34(57)58)40(63)48-30(18-23-8-12-25(53)13-9-23)39(62)47-28(6-2-4-16-43)37(60)46-29(7-3-5-17-44)38(61)50-32(42(65)66)19-24-10-14-26(54)15-11-24/h8-15,22,27-32,35,52-54H,2-7,16-21,43-45H2,1H3,(H,46,60)(H,47,62)(H,48,63)(H,49,64)(H,50,61)(H,51,59)(H,55,56)(H,57,58)(H,65,66)/t22-,27+,28+,29+,30+,31+,32+,35+/m1/s1 InChIKey=GCENTNBSBDGEJN-BXZRIUHRSA-N |
| Database reference: |