BIOPEP-UWM: Report
| ID | 10183 |
| Name | Zinc binding peptide |
| sequence |
| Function: | |||
| Zinc binding | |||
| Number of residues | 9 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 1059.0821 | Monoisotopic mass | 1058.4863 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Udechukwu M. C., Dang C., Udenigwe C. C. | |
| Title | |
| Identification of zinc-binding peptides in ADAM17-inhibiting whey protein hydrolysates using IMAC-Zn2+ coupled with shotgun peptidomics. Food Prod. Process. Nutr., 3, 5, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C43H70N12O19/c1-18(2)31(44)39(70)49-21(8-6-14-47-43(45)46)34(65)54-33(20(5)56)41(72)55-15-7-9-26(55)38(69)48-22(10-12-27(57)58)35(66)53-32(19(3)4)40(71)52-25(17-30(63)64)37(68)51-24(16-29(61)62)36(67)50-23(42(73)74)11-13-28(59)60/h18-26,31-33,56H,6-17,44H2,1-5H3,(H,48,69)(H,49,70)(H,50,67)(H,51,68)(H,52,71)(H,53,66)(H,54,65)(H,57,58)(H,59,60)(H,61,62)(H,63,64)(H,73,74)(H4,45,46,47)/t20-,21+,22+,23+,24+,25+,26+,31+,32+,33+/m1/s1 InChIKey=QCSCIBKFHDREQW-VUVQBBNYSA-N |
| Database reference: |