BIOPEP-UWM: Report
| ID | 10185 |
| Name | Zinc binding peptide |
| sequence |
| Function: | |||
| Zinc binding | |||
| Number of residues | 7 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 789.9819 | Monoisotopic mass | 789.4404 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Udechukwu M. C., Dang C., Udenigwe C. C. | |
| Title | |
| Identification of zinc-binding peptides in ADAM17-inhibiting whey protein hydrolysates using IMAC-Zn2+ coupled with shotgun peptidomics. Food Prod. Process. Nutr., 3, 5, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(CCCCN)C(=O)NCC(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)O InChI=1S/C34H63N9O10S/c1-7-19(4)28(33(51)42-23(34(52)53)11-12-25(36)45)43-31(49)24(16-18(2)3)39-26(46)17-38-29(47)21(10-8-9-14-35)40-30(48)22(13-15-54-6)41-32(50)27(37)20(5)44/h18-24,27-28,44H,7-17,35,37H2,1-6H3,(H2,36,45)(H,38,47)(H,39,46)(H,40,48)(H,41,50)(H,42,51)(H,43,49)(H,52,53)/t19-,20+,21-,22-,23-,24-,27-,28-/m0/s1 InChIKey=JLXGLCLKOHYVQU-NURPUKSJSA-N |
| Database reference: |