BIOPEP-UWM: Report
| ID | 10189 |
| Name | Zinc binding peptide |
| sequence |
| Function: | |||
| Zinc binding | |||
| Number of residues | 6 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 739.8132 | Monoisotopic mass | 739.3529 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Udechukwu M. C., Dang C., Udenigwe C. C. | |
| Title | |
| Identification of zinc-binding peptides in ADAM17-inhibiting whey protein hydrolysates using IMAC-Zn2+ coupled with shotgun peptidomics. Food Prod. Process. Nutr., 3, 5, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CO)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CC(=O)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C36H49N7O10/c1-20(2)15-24(37)31(47)42-28(19-44)33(49)39-25(16-21-7-4-3-5-8-21)32(48)40-26(18-30(38)46)35(51)43-14-6-9-29(43)34(50)41-27(36(52)53)17-22-10-12-23(45)13-11-22/h3-5,7-8,10-13,20,24-29,44-45H,6,9,14-19,37H2,1-2H3,(H2,38,46)(H,39,49)(H,40,48)(H,41,50)(H,42,47)(H,52,53)/t24-,25-,26-,27-,28-,29-/m0/s1 InChIKey=OGTLVNVHKIQOEN-AQRCPPRCSA-N |
| Database reference: |