BIOPEP-UWM: Report
| ID | 10190 |
| Name | Zinc binding peptide |
| sequence |
| Function: | |||
| Zinc binding | |||
| Number of residues | 7 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 851.9823 | Monoisotopic mass | 851.4414 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Udechukwu M. C., Dang C., Udenigwe C. C. | |
| Title | |
| Identification of zinc-binding peptides in ADAM17-inhibiting whey protein hydrolysates using IMAC-Zn2+ coupled with shotgun peptidomics. Food Prod. Process. Nutr., 3, 5, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C43H61N7O11/c1-24(2)20-32(40(57)49-34(43(60)61)21-25(3)4)48-38(55)31(17-18-36(52)53)46-41(58)35-12-9-19-50(35)42(59)26(5)45-39(56)33(23-28-13-15-29(51)16-14-28)47-37(54)30(44)22-27-10-7-6-8-11-27/h6-8,10-11,13-16,24-26,30-35,51H,9,12,17-23,44H2,1-5H3,(H,45,56)(H,46,58)(H,47,54)(H,48,55)(H,49,57)(H,52,53)(H,60,61)/t26-,30-,31-,32-,33-,34-,35-/m0/s1 InChIKey=XWKNFNLSIGWGHV-OLPQHFNPSA-N |
| Database reference: |