BIOPEP-UWM: Report
| ID | 10191 |
| Name | Zinc binding peptide |
| sequence |
| Function: | |||
| Zinc binding | |||
| Number of residues | 6 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 673.8410 | Monoisotopic mass | 673.4150 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Udechukwu M. C., Dang C., Udenigwe C. C. | |
| Title | |
| Identification of zinc-binding peptides in ADAM17-inhibiting whey protein hydrolysates using IMAC-Zn2+ coupled with shotgun peptidomics. Food Prod. Process. Nutr., 3, 5, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C34H55N7O7/c1-6-21(4)28(40-30(43)24(36)15-10-11-17-35)33(46)41-18-12-16-26(41)31(44)37-22(5)29(42)39-27(20(2)3)32(45)38-25(34(47)48)19-23-13-8-7-9-14-23/h7-9,13-14,20-22,24-28H,6,10-12,15-19,35-36H2,1-5H3,(H,37,44)(H,38,45)(H,39,42)(H,40,43)(H,47,48)/t21-,22-,24-,25-,26-,27-,28-/m0/s1 InChIKey=WUYSKKZQUIZLLX-OVELHQAISA-N |
| Database reference: |