BIOPEP-UWM: Report
| ID | 10195 |
| Name | Hypotensive peptide |
| sequence |
| Function: | |||
| Lowering blood pressure in rats | |||
| Number of residues | 6 |
Activity code | hyp |
| Activity : | hypotensive |
|||
| Chemical mass | 626.7401 | Monoisotopic mass | 626.3627 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Pei J., Hua Y., Zhou T., Gao X., Dang Y., Wang Y. | |
| Title | |
| Transport, in vivo antihypertensive effect, and pharmacokinetics of an angiotensin-converting enzyme (ACE) inhibitory peptide LVLPGE. J. Agric. Food Chem., 69, 2149–2156, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C29H50N6O9/c1-15(2)12-18(30)25(39)34-24(17(5)6)27(41)33-20(13-16(3)4)28(42)35-11-7-8-21(35)26(40)31-14-22(36)32-19(29(43)44)9-10-23(37)38/h15-21,24H,7-14,30H2,1-6H3,(H,31,40)(H,32,36)(H,33,41)(H,34,39)(H,37,38)(H,43,44)/t18-,19-,20-,21-,24-/m0/s1 InChIKey=VLKYKEAXTIBHRI-TVJXPIDLSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides (ID 10196) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 10196 |