BIOPEP-UWM: Report
| ID | 10197 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 6 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 760.9181 | Monoisotopic mass | 760.4469 | |
| IC50 : | 7.28 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lin K., Zhang L., Han X., Cheng D. | |
| Title | |
| Novel angiotensin I-converting enzyme inhibitory peptides from protease hydrolysates of Qula casein: Quantitative structure-activity relationship modeling and molecular docking study. J. Funct. Foods, 32, 266-277, 2017 | |
| Year | Source |
| 2017 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCCN)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)O InChI=1S/C37H60N8O9/c1-5-21(3)30(35(51)41-26(37(53)54)16-17-29(40)47)43-34(50)28-11-9-19-45(28)36(52)31(22(4)6-2)44-33(49)27(20-23-12-14-24(46)15-13-23)42-32(48)25(39)10-7-8-18-38/h12-15,21-22,25-28,30-31,46H,5-11,16-20,38-39H2,1-4H3,(H2,40,47)(H,41,51)(H,42,48)(H,43,50)(H,44,49)(H,53,54)/t21-,22-,25-,26-,27-,28-,30-,31-/m0/s1 InChIKey=CJDVIVZTDWNPIC-LCEIJQIJSA-N |
| Database reference: |