BIOPEP-UWM: Report
| ID | 10198 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 6 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 664.8738 | Monoisotopic mass | 664.4509 | |
| IC50 : | 10.46 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lin K., Zhang L., Han X., Cheng D. | |
| Title | |
| Novel angiotensin I-converting enzyme inhibitory peptides from protease hydrolysates of Qula casein: Quantitative structure-activity relationship modeling and molecular docking study. J. Funct. Foods, 32, 266-277, 2017 | |
| Year | Source |
| 2017 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C34H60N6O7/c1-19(2)15-23(35)32(44)39-13-9-11-27(39)31(43)37-25(17-21(5)6)33(45)40-14-10-12-28(40)30(42)36-24(16-20(3)4)29(41)38-26(34(46)47)18-22(7)8/h19-28H,9-18,35H2,1-8H3,(H,36,42)(H,37,43)(H,38,41)(H,46,47)/t23-,24-,25-,26-,27-,28-/m0/s1 InChIKey=KTNPPDBWNBJXQB-QUQVWLGBSA-N |
| Database reference: |