BIOPEP-UWM: Report
| ID | 10199 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 8 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 837.9591 | Monoisotopic mass | 837.4371 | |
| IC50 : | 12.79 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lin K., Zhang L., Han X., Cheng D. | |
| Title | |
| Novel angiotensin I-converting enzyme inhibitory peptides from protease hydrolysates of Qula casein: Quantitative structure-activity relationship modeling and molecular docking study. J. Funct. Foods, 32, 266-277, 2017 | |
| Year | Source |
| 2017 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(=O)N)C(=O)O InChI=1S/C41H59N9O10/c1-3-24(2)34(40(58)50-20-10-16-31(50)37(55)46-28(41(59)60)22-32(42)51)47-38(56)30-15-8-18-48(30)33(52)23-44-36(54)29-14-9-19-49(29)39(57)27(21-25-11-5-4-6-12-25)45-35(53)26-13-7-17-43-26/h4-6,11-12,24,26-31,34,43H,3,7-10,13-23H2,1-2H3,(H2,42,51)(H,44,54)(H,45,53)(H,46,55)(H,47,56)(H,59,60)/t24-,26-,27-,28-,29-,30-,31-,34-/m0/s1 InChIKey=HKCGEBVAGCUYDX-NSIGZTGPSA-N |
| Database reference: |